Synonym: Astramembrangenin; Cyclosieversigenin; Cyclosiversigenin; GRN510; TAT2; (3β,6α,16β,20R,24S)-20,24-Epoxy-9,19-cyclolanostane-3,6,16,25-tetrol; Astramembrangenin; Cyclogalegigenin; Cyclosieversigenin
CAS Number: 78574-94-4
Empirical Formula (Hill Notation): C30H50O5
Molecular Weight: 490.72
MDL Number: MFCD24849201
Linear Formula: C30H50O5
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C30H50O5/c1-24(2)20(33)8-11-30-16-29(30)13-12-26(5)23(28(7)10-9-21(35-28)25(3,4)34)18(32)15-27(26,6)19(29)14-17(31)22(24)30/h17-23,31-34H,8-16H2,1-7H3/t17-,18-,19-,20-,21-,22-,23-,26+,27-,28+,29-,30+/m0/s1 |
| InChI key |
WENNXORDXYGDTP-UOUCMYEWSA-N |
| optical activity |
[α]/D +45 to +60°, c = 1 in methanol |
| Quality Level |
100  |
| SMILES string |
C[C@]1(O[C@H](C(O)(C)C)CC1)[C@@]2([H])[C@@H](O)C[C@@]3(C)[C@]4([H])C[C@H](O)[C@@]5([H])C(C)(C)[C@@H](O)CC[C@]5(C6)[C@]46CC[C@@]32C |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Cycloastragenol is an aglycone of astragaloside IV isolated from Astragalus species that exhibits anti-inflammatory properties and promotes and wound gap closure. Cycloastragenol enhances the antiviral response in human CD8+ T-lymphocytes. Cycloastragenol induces telomerase activity and induces CREB (cAMP response element binding) activation in human neonatal keratinocytes, PC12 cells, and primary neurons. |
| General description: |
Cycloastragenol is isolated from Astragalus species. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |