Synonym: (2E)-1-[2,4-Dihydroxy-3-(3-methyl-2-butenyl)phenyl]-3-(4-hydroxyphenyl)-2-propen-1-one; 2′,4,4′-Trihydroxy-3′-(3-methyl-2-butenyl)-chalcone; Corylifolinin; Isobacachalcone
CAS Number: 20784-50-3
Empirical Formula (Hill Notation): C20H20O4
Molecular Weight: 324.37
MDL Number: MFCD00902090
Linear Formula: C20H20O4
Product Type: Chemical
| assay |
≥98% (HPCE) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C20H20O4/c1-13(2)3-9-16-19(23)12-10-17(20(16)24)18(22)11-6-14-4-7-15(21)8-5-14/h3-8,10-12,21,23-24H,9H2,1-2H3/b11-6+ |
| InChI key |
DUWPGRAKHMEPCM-IZZDOVSWSA-N |
| Quality Level |
100  |
| SMILES string |
OC1=C(CC=C(C)C)C(O)=C(C(/C=C/C2=CC=C(O)C=C2)=O)C=C1 |
| solubility |
DMSO: 5 mg/mL, clear (warmed) |
| storage condition |
desiccated |
| |
protect from light |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Isobavachalcone is a chalcone isolated from multipurpose medical plant Psoralea corylifolia that inhibits LPS-induced ICAM-1 expression and leukocyte adhesion to brain endothelial cells. It appears that isobavachalcone modulates both MyD88-dependent and TRIF-dependent signaling of toll-like receptor 4 (TLR4). Isobavachalcone significantly inhibits both oligomerization and fibrillization of Aβ42. Isobavachalcone exhibits a wide spectrum of biological activities including antioxidative, antiplatelet, antimicrobial, anti-inflammatory, antitumor, and neuroprotective. |
| Biochem/physiol Actions: |
Isobavachalcone is a chalcone isolated from multipurpose medical plant Psoralea corylifolia that inhibits LPS-induced ICAM-1 expression and leukocyte adhesion to brain endothelial cells. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPCE) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
