Synonym: 1-(2,4,6-Trihydroxyphenyl)-1-nonanone; 1-(3,4,5-Trihydroxyphenyl)nonan-1-one; CID 3063200
CAS Number: 100079-26-3
Empirical Formula (Hill Notation): C15H22O4
Molecular Weight: 266.33
Linear Formula: C15H22O4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C15H22O4/c1-2-3-4-5-6-7-8-12(16)11-9-13(17)15(19)14(18)10-11/h9-10,17-19H,2-8H2,1H3 |
| InChI key |
NVFRHTFJDGAFQS-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
OC1=C(O)C(O)=CC(C(CCCCCCCC)=O)=C1 |
| solubility |
DMSO: 25 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
THPN is potent nuclear receptor TR3 (Nur77) antagonist that induces autophagic cell death in melanoma. |
| Biochem/physiol Actions: |
THPN is potent nuclear receptor TR3 (Nur77) antagonist that induces autophagic cell death in melanoma. Co-application of THPN with Akt2 inhibitors significantly represses tumor growth in xenograft mouse model. |
| General description: |
THPN or 1-(3,4,5-Trihydroxyphenyl)nonan-1-one, is a derivative of cytosporone B. |
| Other Notes: |
air sensitive |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P301 + P312 + P330 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
