Synonym: (αE)-α-[(4R)-4-(2,4-Dichlorophenyl)-1,3-dithiolan-2-ylidene]-1H-imidazole-1-acetonitrile; NND 502; [R-(E)]-α-[4-(2,4-Dichlorophenyl)-1,3-dithiolan-2-ylidene]-1H-imidazole-1-acetonitrile
CAS Number: 187164-19-8
Empirical Formula (Hill Notation): C14H9Cl2N3S2
Molecular Weight: 354.28
MDL Number: MFCD00953915
Linear Formula: C14H9Cl2N3S2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C14H9Cl2N3S2/c15-9-1-2-10(11(16)5-9)13-7-20-14(21-13)12(6-17)19-4-3-18-8-19/h1-5,8,13H,7H2/b14-12+/t13-/m0/s1 |
| InChI key |
YTAOBBFIOAEMLL-REQDGWNSSA-N |
| Quality Level |
100  |
| SMILES string |
N#C/C(N1C=NC=C1)=C2SC[C@@H](C3=C(Cl)C=C(Cl)C=C3)S/2 |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Luliconazole is an imidazole antifungal. |
| Biochem/physiol Actions: |
Luliconazole is an imidazole antifungal. Its mechanism of action involves inhibition of ergosterol biosynthesis by inhibition of sterol 14α-demethylase. |
| General description: |
Luliconazole also called LLCZ, {(−)-(E)-[(4R)-4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene](1H-imidazol-1-yl) acetonitrile} is optically active compound. It is used as a topical medicine for treating dermatophytosis and dermatitis. It is a potential antifungal against Candida and other fungal infections of skin, groin and feet. |
| Packaging: |
10, 50 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H315 - H319 |
| Precautionary statements |
P305 + P351 + P338 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
