Synonym: Benzamide, 2,6-dichloro-4-(dimethylamino)-N-[3-(1,1-dimethylethyl)-4-hydroxyphenyl]-N-(phenylmethyl)-; N-Benzyl-N-(3-tert-butyl-4-hydroxy-phenyl)-2,6-dichloro-4-dimethylamino-benzamide
CAS Number: 1660153-08-1
Empirical Formula (Hill Notation): C26H28Cl2N2O2
Molecular Weight: 471.42
Linear Formula: C26H28Cl2N2O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C26H28Cl2N2O2/c1-26(2,3)20-13-18(11-12-23(20)31)30(16-17-9-7-6-8-10-17)25(32)24-21(27)14-19(29(4)5)15-22(24)28/h6-15,31H,16H2,1-5H3 |
| InChI key |
IDACWMHIKWNAEO-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CN(C)C1=CC(Cl)=C(C(N(CC2=CC=CC=C2)C3=CC(C(C)(C)C)=C(O)C=C3)=O)C(Cl)=C1 |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
NDB is a selective antagonist of human Farnesoid X receptor α (FXRα) that effectively modulates FXRα down-stream genes. |
| Biochem/physiol Actions: |
NDB is a selective antagonist of human Farnesoid X receptor α. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
51111800 |