Synonym: 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetamide, 4-(4-chlorophenyl)-N-(4-hydroxyphenyl)-2,3,9-trimethyl-, (6S)-; OTX-015
CAS Number: 202590-98-5
Empirical Formula (Hill Notation): C25H22ClN5O2S
Molecular Weight: 491.99
MDL Number: MFCD26960949
Linear Formula: C25H22ClN5O2S
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to light brown |
| form |
powder |
| InChI |
1S/C25H22ClN5O2S/c1-13-14(2)34-25-22(13)23(16-4-6-17(26)7-5-16)28-20(24-30-29-15(3)31(24)25)12-21(33)27-18-8-10-19(32)11-9-18/h4-11,20,32H,12H2,1-3H3,(H,27,33)/t20-/m0/s1 |
| InChI key |
GNMUEVRJHCWKTO-FQEVSTJZSA-N |
| Quality Level |
100  |
| SMILES string |
O=C(NC(C=C1)=CC=C1O)C[C@H]2C3=NN=C(C)N3C(SC(C)=C4C)=C4C(C5=CC=C(Cl)C=C5)=N2 |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
It binds to bromodomain and extra-terminal domain (BET) proteins and inhibits their binding to the chromatin. This in turn prevents gene transcription. OTX015 has been shown to inhibit proliferation of cells in haematological malignancies. |
| Biochem/physiol Actions: |
OTX015 is a potent inhibitor of the BET bromodomain proteins 2, 3, and 4 (BRD2/3/4). |
| Biochem/physiol Actions: |
OTX015 is a potent inhibitor of the BET bromodomain proteins 2, 3, and 4. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
