Synonym: 5,6,7,8-Tetrahydro-3-[2-[4-(2-methylphenyl)-1-piperazinyl]ethyl]-1,2,4-triazolo[4,3-a]pyridine hydrochloride
CAS Number: 72822-13-0
Empirical Formula (Hill Notation): C19H27N5 · HCl
Molecular Weight: 361.91
MDL Number: MFCD00941400
Linear Formula: C19H27N5 · HCl
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C19H27N5.ClH/c1-16-6-2-3-7-17(16)23-14-12-22(13-15-23)11-9-19-21-20-18-8-4-5-10-24(18)19;/h2-3,6-7H,4-5,8-15H2,1H3;1H |
| InChI key |
ZIODNPFQZIHCOE-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC1=CC=CC=C1N2CCN(CCC3=NN=C4N3CCCC4)CC2.[H]Cl |
| solubility |
DMSO: 20 mg/mL, clear |
| storage condition |
desiccated |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Dapiprazole hydrochloride is an an α-adrenergic blocking agent that is used to reverse mydriasis after eye examination. |
| Biochem/physiol Actions: |
Dapiprazole hydrochloride is an an α-adrenergic blocking agent. |
| Packaging: |
10, 50 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H315 - H319 |
| Precautionary statements |
P305 + P351 + P338 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
