Synonym: 6′′-Fluoro-4-(4-methyl-4H-[1,2,4]triazol-3-yl)-3,4,5,6-tetrahydro-2H-[1,2′;3′,3′′]terpyridine
CAS Number: 2117405-13-5
Empirical Formula (Hill Notation): C18H19FN6
Molecular Weight: 338.38
Linear Formula: C18H19FN6
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C18H19FN6/c1-24-12-22-23-17(24)13-6-9-25(10-7-13)18-15(3-2-8-20-18)14-4-5-16(19)21-11-14/h2-5,8,11-13H,6-7,9-10H2,1H3 |
| InChI key |
AJIAMIPUWJQSPR-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
FC(C=C1)=NC=C1C2=CC=CN=C2N(CC3)CCC3C4=NN=CN4C |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
SEN177 is a Glutaminyl cyclase (QPCT) inhibitor. |
| Biochem/physiol Actions: |
SEN177 is a Glutaminyl cyclase (QPCT) inhibitor. Glutaminyl cyclase modifies N-terminal glutamine or glutamate residues to N-terminal 5-oxoproline or pyroglutamate (named QPCT). QPCT inhibits mutant huntingtin from forming aggregates, but also reduces aggregation of other aggregate-prone proteins containing polyQ or polyA repeats. SEN177 caused dose-dependent decreases in HTT aggregation by a mechanism that requires QPCT inhibition. SEN177 had in vitro activity against polyglutamine toxicity and was able to reduce aggregates in mammalian cells, primary neurons and in a Drosophila model. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 |
| Precautionary statements |
P301 + P330 + P331 + P310 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
