Synonym: (17β)-10,17-Dihydroxy-estra-1,4-dien-3-one; 10β,17β-Dihydroxyestra-1,4-dien-3-one; 3,16-Dihydroxyandrost-5-ene-17,19-dione
CAS Number: 549-02-0
Empirical Formula (Hill Notation): C18H24O3
Molecular Weight: 288.38
Linear Formula: C18H24O3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to light brown |
| form |
powder |
| InChI |
1S/C18H24O3/c1-17-8-7-15-13(14(17)4-5-16(17)20)3-2-11-10-12(19)6-9-18(11,15)21/h6,9-10,13-16,20-21H,2-5,7-8H2,1H3/t13-,14-,15-,16-,17-,18+/m0/s1 |
| InChI key |
UIKDFTLKOKNUJP-UGDFAFBOSA-N |
| optical activity |
[α]/D -20 to -30°, c = 1 in methanol |
| Quality Level |
100  |
| SMILES string |
O[C@@]12C(CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4O)=CC(C=C1)=O |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Application: |
DHED has been used to induce an increase of estrogen levels in 3K transgenic mice with Parkinson′s disease (PD)-like motor syndrome. |
| Biochem/physiol Actions: |
DHED (10β,17β-dihydroxyestra-1,4-dien-3-one) is an inactive prodrug that selectively produces estrogen solely in the brain. DHED is converted to 17β-estradiol in the brain by an enzyme only expressed in the CNS, but is inert in the rest of the body. DHED was found to provide neuroprotection in a rat stroke model and reversed neurological symptoms of estrogen deprivation such as memory problems in female rats lacking ovaries. |
| Biochem/physiol Actions: |
DHED is a substrate for nicotinamide adenine dinucleotide phosphate (NADPH)-dependent dehydrogenase/reductase. Its expression in the brain is correlated to neuroprotection functionality. |
| Symbol |
 GHS08 |
| Signal word |
Danger |
| Hazard statements |
H360Df |
| Precautionary statements |
P201 - P280 - P308 + P313 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
