Synonym: 2,4,7-Triamino-6-(m-chlorophenyl)-pteridine; 6-(3-Chlorophenyl)-2,4,7-pteridinetriamine
CAS Number: 16470-02-3
Empirical Formula (Hill Notation): C12H10ClN7
Molecular Weight: 287.71
MDL Number: MFCD02947161
Linear Formula: C12H10ClN7
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to light brown |
| form |
powder |
| InChI |
1S/C12H10ClN7/c13-6-3-1-2-5(4-6)7-9(14)18-11-8(17-7)10(15)19-12(16)20-11/h1-4H,(H6,14,15,16,18,19,20) |
| InChI key |
ZWNKKZSRANLVEW-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
NC1=NC(N)=C2C(N=C(N)C(C3=CC=CC(Cl)=C3)=N2)=N1 |
| solubility |
DMSO: 1 mg/mL, clear (warmed) |
| storage temp. |
room temp |
| Biochem/physiol Actions: |
Epiblastin A is triamterene derivative that potently induces reprograming of epiblast stem cells (EpiSC) into embryonic stem cells (ESC). |
| Biochem/physiol Actions: |
Epiblastin A is triamterene derivative that potently induces reprograming of epiblast stem cells (EpiSC) into embryonic stem cells (ESC). Epiblastin A is a potent reversible inhibitor of casein kinase 1 (CK1) α, δ, and ε that binds to ATP-binding site. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
room temp |
| UNSPSC |
12352200 |
