Urolithin B
SIGMA/SML1649 - ≥95% (HPLC)
Synonym: 3-
CAS Number: 1139-83-9
Empirical Formula (Hill Notation): C13H8O3
Molecular Weight: 212.20
MDL Number: MFCD00034338
Linear Formula: C13H8O3
Product Type: Chemical
| assay | ≥95% (HPLC) |
| color | white to beige |
| form | powder |
| InChI | 1S/C13H8O3/c14-8-5-6-10-9 |
| InChI key | WXUQMTRHPNOXBV-UHFFFAOYSA |
| Quality Level | 100  |
| SMILES string | [o]1c2c(c3c([c]1=O)cccc3) |
| solubility | DMSO: 5 mg/mL, clear (warmed) |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | It decreases protein degradation and induces muscle hypertrophy. Urolithin B inhibits the activity of aromatase, an enzyme that interconverts estrogen and testosterone. |
| Biochem/physiol Actions: | Urolithin B is a natural product with antiproliferative and antioxidant activity. |
| Biochem/physiol Actions: | Urolithin B is a natural product with antiproliferative and antioxidant activity. Urolithin B is formed by metabolism from polyphenols found in some nuts and fruits, particularly pomegranates. Urolithin B has been shown to cross the blood brain barrier, and may have neuroprotective effects against Alzheimer’s Disease. |
| Packaging: | 10, 50 mg in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 |
| Precautionary statements | P301 + P312 + P330 - P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |