Synonym: 1,4-Naphthalenedione,2-[[4-(1,1-dimethylethyl)cyclohexyl]methyl]-3-; Butalex; UNII-0354RT7LG4; 2-[(4-tert-Butylcyclohexyl)methyl]-3-hydroxy-1,4-naphthoquinone; 2-[[4-(1,1-Dimethylethyl)cyclohexyl]methyl]-3-hydroxy-1,4-naphthalenedione
CAS Number: 88426-33-9
Empirical Formula (Hill Notation): C21H26O3
Molecular Weight: 326.43
MDL Number: MFCD01712789
Linear Formula: C21H26O3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| form |
powder |
| InChI |
1S/C21H26O3/c1-21(2,3)14-10-8-13(9-11-14)12-17-18(22)15-6-4-5-7-16(15)19(23)20(17)24/h4-7,13-14,24H,8-12H2,1-3H3 |
| InChI key |
KLLIVCPQDTYMLC-UHFFFAOYSA-N |
| Quality Level |
200  |
| SMILES string |
CC(C)(C)C1CCC(CC1)CC2=C(O)C(=O)c3ccccc3C2=O |
| solubility |
chloroform: soluble |
| |
DMSO: soluble |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Buparvaquone is a second-generation hydroxynaphthoquinone antiprotozoal drug related to parvaquone and atovaquone. Buparvaquone is indicated for the therapy and prophylaxis of all forms of Theileriosis and found to have an anti-Leishmanial activity. |
| Hazard statements |
H413 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
