Synonym: (8S)-3,8-Bis[[(1,1-dimethylethoxy)carbonyl]amino]-9-oxo-2,4,10,17-tetraazaoctadec-3-enedioic acid 1-(1,1-dimethylethyl) 18-(phenylmethyl) ester
CAS Number: 1884710-81-9
Empirical Formula (Hill Notation): C35H58N6O9
Molecular Weight: 706.87
Linear Formula: C35H58N6O9
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C35H58N6O9/c1-33(2,3)48-30(44)39-26(20-17-23-37-28(40-31(45)49-34(4,5)6)41-32(46)50-35(7,8)9)27(42)36-21-15-10-11-16-22-38-29(43)47-24-25-18-13-12-14-19-25/h12-14,18-19,26H,10-11,15-17,20-24H2,1-9H3,(H,36,42)(H,38,43)(H,39,44)(H2,37,40,41,45,46)/t26-/m |
| InChI key |
JGEWUYSTHGIDHO-SANMLTNESA-N |
| Quality Level |
100  |
| SMILES string |
O=C(OCC1=CC=CC=C1)NCCCCCCNC([C@H](CCCN/C(NC(OC(C)(C)C)=O)=NC(OC(C)(C)C)=O)NC(OC(C)(C)C)=O)=O |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Cbz-B3A is a potent and selective inhibitor of mTORC1 signaling that inhibits the phosphorylation of eIF4E binding protein 1 (4EBP1) and blocks 68% of translation. Cbz-B3A binds to ubiquilins 1, 2, and 4, which prevents mTORC1 activation. |
| Biochem/physiol Actions: |
Cbz-B3A is a potent and selective inhibitor of mTORC1 signaling. |
| Other Notes: |
Light and air sensitive. |
| Packaging: |
5 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
