Synonym: (3S)-2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid; L-1,2,3,4-Tetrahydronorharman-3-carboxylic acid; Lycoperodine-1
CAS Number: 42438-90-4
Empirical Formula (Hill Notation): C12H12N2O2
Molecular Weight: 216.24
MDL Number: MFCD00272641
Linear Formula: C12H12N2O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16)/t10-/m0/s1 |
| InChI key |
FSNCEEGOMTYXKY-JTQLQIEISA-N |
| optical activity |
[α]/D -57 to -67°, c = 1 (in MeOH:1N HCl (1:1)) |
| Quality Level |
100  |
| SMILES string |
O=C(O)[C@H]1NCC2=C(C3=C(N2)C=CC=C3)C1 |
| solubility |
1.5 mg/mL, clear (Solvent: 0.1N HCl:DMSO (1:1); warmed) |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
TNCA is a tryptophan derivative that binds the parathyroid Ca2+-sensing receptor (CaSR) extracellular domain (ECD) hinge region between two globular subdomains and acts as a high-affinity CaSR ligand (CaSRL) with co-agonist activity. TNCA is shown to potentiate both Mg++- and Ca++-evoked cellular calcium response (0.1-0.5 mM), as well as Mg++-evoked cellular ERK1/2 phosphorylation in CaSR-expressing HEK293 cells (0.5 mM). AC-265347 (Cat. No. SML0129), on the other hand, is a calcimimetic that functions as a CaSR agonist. |
| Packaging: |
10, 50 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
