Synonym: 4-((4-Benzyl-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl)thio)pyrido[3′,2′,4,5]-thieno[3,2-d]pyrimidine; 4-[[4-(Phenylmethyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-pyrido[3′,2′:4,5]thieno[3,2-d]pyrimidine
CAS Number: 1841460-82-9
Empirical Formula (Hill Notation): C23H15N7S2
Molecular Weight: 453.54
Linear Formula: C23H15N7S2
Product Type: Chemical
| assay |
≥95% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C23H15N7S2/c1-2-5-15(6-3-1)13-30-20(16-8-11-24-12-9-16)28-29-23(30)32-22-19-18(26-14-27-22)17-7-4-10-25-21(17)31-19/h1-12,14H,13H2 |
| InChI key |
CBBXTGWSGPEJEE-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
C1(C2=CC=NC=C2)=NN=C(SC3=NC=NC4=C3SC5=C4C=CC=N5)N1CC6=CC=CC=C6 |
| solubility |
DMSO: 3 mg/mL, clear (warmed) |
| storage temp. |
2-8°C |
| Application: |
TH1020 has been used to inhibit toll-like receptor 5 (TLR5) in porcine intestinal epithelial monolayer cells and mice. |
| Biochem/physiol Actions: |
TH1020 is a non-cytotoxic non-cytotoxic toll-like receptor 5 (TLR5)/flagellin complex inhibitor. |
| Biochem/physiol Actions: |
TH1020 is a non-cytotoxic non-cytotoxic toll-like receptor 5 (TLR5)/flagellin complex inhibitor. TH1020 selectively prevents flagellin-induced TLR5 signaling without affecting ligands-induced activation of TLR2, TLR3, TLR4, TLR7 or TLR8. |
| Biochem/physiol Actions: |
TH1020 mediates the inhibition of tumor necrosis factor-α (TNF-α) based signaling, It disrupts tetrameric complex by binding the molecular interface between dimeric TLR5. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
51111800 |
