Synonym: 4-(4-Methoxyphenyl)-1-piperazinecarboxylic acid hexahydro-1,3-dioxo-7-[[1-(phenylmethyl)-4-piperidinyl]methyl]imidazo[1,5-a]pyrazin-2-yl ester; 7-((1-Benzylpiperidin-4-yl)methyl)-1,3-dioxohexahydroimidazo[1,5-a]pyrazin-2(3H)-yl 4-(4-methoxyphenyl)piperazine-1-carboxylate
CAS Number: 1831135-46-6
Empirical Formula (Hill Notation): C31H40N6O5
Molecular Weight: 576.69
Linear Formula: C31H40N6O5
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C31H40N6O5/c1-41-27-9-7-26(8-10-27)34-16-18-35(19-17-34)31(40)42-37-29(38)28-23-33(15-20-36(28)30(37)39)22-25-11-13-32(14-12-25)21-24-5-3-2-4-6-24/h2-10,25,28H,11-23H2,1H3 |
| InChI key |
YHRQLTHMALGXOG-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
O=C(N1OC(N2CCN(C3=CC=C(OC)C=C3)CC2)=O)C(CN(CC4CCN(CC5=CC=CC=C5)CC4)CC6)N6C1=O |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
ABC44 is a cell-active, potent and selective inhibitor of palmitoyl-protein thioesterase 1 (PPT-1). |
| Biochem/physiol Actions: |
Cell-active, potent and selective inhibitor of palmitoyl-protein thioesterase 1 (PPT-1) |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H315 - H319 - H335 |
| Precautionary statements |
P305 + P351 + P338 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
