Synonym: 7-Bromo-2-(2-methyl-allylsulfanyl)-9H-1,3,4,9-tetraaza-fluorene; 7-Bromo-3-[(2-methyl-2-propen-1-yl)thio]-5H-1,2,4-Triazino[5,6-b]indole
CAS Number: 2032282-97-4
Empirical Formula (Hill Notation): C13H11BrN4S
Molecular Weight: 335.22
Linear Formula: C13H11BrN4S
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C13H11BrN4S/c1-7(2)6-19-13-16-12-11(17-18-13)9-4-3-8(14)5-10(9)15-12/h3-5H,1,6H2,2H3,(H,15,16,18) |
| InChI key |
OVDAOBDZJJZJMY-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC(CSC(N=N1)=NC2=C1C3=C(N2)C=C(Br)C=C3)=C |
| solubility |
DMSO: 1 mg/mL, clear (warmed) |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Rbin-2 (ribozinoindole-2) is a cell penetrant, potent, selective and reversible inhibitor of Midasin that inhibits eukaryotic ribosome biogenesis. Rbin-2 directly targets AAA+ ATPase Midasin. |
| Biochem/physiol Actions: |
Rbin-2 (ribozinoindole-2) is a cell penetrant, potent, selective and reversible inhibitor of Midasin. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
