Synonym: 1-(2-Chlorophenyl)-1-(4-chlorophenyl)-2,2-dichloroethane; 1-Chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethyl]-benzene; 2,4′-DDD; o,p′-DDD
CAS Number: 53-19-0
Empirical Formula (Hill Notation): C14H10Cl4
Molecular Weight: 320.04
EC Number: 200-166-6
MDL Number: MFCD00000850
Linear Formula: C14H10Cl4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C14H10Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8,13-14H |
| InChI key |
JWBOIMRXGHLCPP-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
ClC1=C(C(C(Cl)Cl)C2=CC=C(Cl)C=C2)C=CC=C1 |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Mitotane is a selective inhibitor of sterol-Oacyl-transferase 1 (SOAT1), also known as ACAT1, (acyl-coenzyme A cholesterol acyltransferase). |
| Biochem/physiol Actions: |
Mitotane is a selective inhibitor of sterol-Oacyl-transferase 1 (SOAT1), also known as ACAT1, (acyl-coenzyme A cholesterol acyltransferase). Mitotane inhibition of SOAT1 in adrenocortical carcinoma cells decreased the formation of cholesteryl esters, which increased free cholesterol levels and caused endoplasmic reticulum (ER) stress, the unfolded protein response, and eventually apoptosis. |
| Packaging: |
100 mg in glass bottle |
| Symbol |
 GHS08 |
| Signal word |
Warning |
| Hazard statements |
H351 |
| Precautionary statements |
P280 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
