Synonym: (2S)-2-Hydroxy-3-methyl-N-[(1S)-1-methyl-2-oxo-2-[[(1S)-2,3,4,5-tetrahydro-3-methyl-2-oxo-1H-3-benzazepin-1-yl]amino]ethyl]-butanamide; LY 450139; LY-450139; Semagacestat
CAS Number: 425386-60-3
Empirical Formula (Hill Notation): C19H27N3O4
Molecular Weight: 361.44
MDL Number: MFCD09970409
Linear Formula: C19H27N3O4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C19H27N3O4/c1-11(2)16(23)18(25)20-12(3)17(24)21-15-14-8-6-5-7-13(14)9-10-22(4)19(15)26/h5-8,11-12,15-16,23H,9-10H2,1-4H3,(H,20,25)(H,21,24)/t12-,15-,16-/m0/s1 |
| InChI key |
PKXWXXPNHIWQHW-RCBQFDQVSA-N |
| Quality Level |
100  |
| SMILES string |
O=C([C@@H](NC([C@@H](O)C(C)C)=O)C)N[C@@H](C1=CC=CC=C1CCN2C)C2=O |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
LY450139 (Semagacestat) is a notch-sparing, potent and selective gamma-secretase inhibitor. LY450139 lowers plasma and cerebrospinal fluid Aβ in humans. |
| Biochem/physiol Actions: |
Notch-sparing, potent and selective gamma-secretase inhibitor and inverse modulator of Aβ |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
