Synonym: 1-[(3,4-Diethoxyphenyl)methylene]-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride; 3′,4′,6,7-Tetraethoxy-1-benzylidene-1,2,3,4-tetrahydroisoquinoline hydrochloride; Drotaverin hydrochloride; Tetraspasmin-Lefa
CAS Number: 985-12-6
Empirical Formula (Hill Notation): C24H31NO4 · HCl
Molecular Weight: 433.97
MDL Number: MFCD00347721
Linear Formula: C24H31NO4 · HCl
Product Type: Chemical
| assay |
≥95% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C24H31NO4.ClH/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20;/h9-10,13-16,25H,5-8,11-12H2,1-4H3;1H/b20-13-; |
| InChI key |
JBFLYOLJRKJYNV-MASIZSFYSA-N |
| Quality Level |
100  |
| SMILES string |
CCOC1=CC=C(/C=C2C3=C(CCN/2)C=C(OCC)C(OCC)=C3)C=C1OCC.[H]Cl |
| solubility |
DMSO: 2 mg/mL, clear (warmed) |
| storage condition |
desiccated |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
A PDE4-selective phosphodiesterase inhibitor and an L-type voltage-dependent calcium channel blocker with in vivo antispasmodic efficacy. |
| Biochem/physiol Actions: |
Drotaverine (Drotaverin) is an isoquinoline-based PDE4-selective phosphodiesterase (PDE) inhibitor and an L-type voltage-dependent (voltage-operated) calcium channel (L-VDCC or L-VOCC) blocker that exhibits in vivo antispasmodic efficacy without anticholinergic effects. |
| Biochem/physiol Actions: |
It is a benzylisoquinoline derivative. Drotaverine acts as a smooth muscle relaxant. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P301 + P312 + P330 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
