Synonym: 4-((4-(2-Fluorophenyl)piperazin-1-yl)methyl)-6-imino-N-(naphthalen-1-yl)-1,3,5-triazin-2-amine; 6-[[4-(2-Fluorophenyl)-1-piperazinyl]methyl]-N2-1-naphthalenyl-1,3,5-triazine-2,4-diamine
CAS Number: 924866-33-1
Empirical Formula (Hill Notation): C24H24FN7
Molecular Weight: 429.49
Linear Formula: C24H24FN7
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C24H24FN7/c25-19-9-3-4-11-21(19)32-14-12-31(13-15-32)16-22-28-23(26)30-24(29-22)27-20-10-5-7-17-6-1-2-8-18(17)20/h1-11H,12-16H2,(H3,26,27,28,29,30) |
| InChI key |
XJZDKGZTSXGLMG-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
FC(C=CC=C1)=C1N2CCN(CC3=NC(NC4=C(C=CC=C5)C5=CC=C4)=NC(N)=N3)CC2 |
| solubility |
DMSO: 2 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
FPMINT is a potent, irreversible and non-competitive inhibitor of equilibrative nucleoside transporters ENT1 and ENT2. FPMINT is more selective for ENT2 than ENT1. |
| Biochem/physiol Actions: |
Potent, irreversible and non-competitive inhibitor of ENT1 and ENT2 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
