Synonym: 4-(di-1H-Indol-3-ylmethyl)-benzoic acid methyl ester; Benzoic acid, 4-(di-1H-indol-3-ylmethyl)-, methyl ester
CAS Number: 151358-48-4
Empirical Formula (Hill Notation): C25H20N2O2
Molecular Weight: 380.44
Linear Formula: C25H20N2O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
pink to light red |
| form |
powder |
| InChI |
1S/C25H20N2O2/c1-29-25(28)17-12-10-16(11-13-17)24(20-14-26-22-8-4-2-6-18(20)22)21-15-27-23-9-5-3-7-19(21)23/h2-15,24,26-27H,1H3 |
| InChI key |
BBAOKSZCULLDIW-UHFFFAOYSA-N |
| SMILES string |
O=C(OC)C1=CC=C(C(C2=CNC3=C2C=CC=C3)C4=CNC5=CC=CC=C54)C=C1 |
| solubility |
DMSO: 2 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
DIM-C-pPhCO2Me is a NR4A1 (Nur77) antagonist that exhibit potent anticancer activity in pancreatic, colon, breast, kidney, and rhabdomyosarcoma cells. DIM-C-pPhCO2Me decreases expression of PAX3-FOXO1A and β1-integrin proteins in Rh30 rhabdomyosarcoma and MDA-MB-231 breast cancer cells. DIM-C-pPhCO2Me inhibits migration of Rh30 and MDA-MB-231 cancer cells. |
| Biochem/physiol Actions: |
DIM-C-pPhCO2Me is also known as 1,1-bis(3′-indolyl)-1-(p-carboxymethylphenyl)methane. In pancreatic and colon cancer cells, DIM-C-pPhCO2Me plays an inhibitory role on cell migration. DIM-C-pPhCO2Me prevents the action of mechanistic target of rapamycin (mTOR) and reduces the multiplication and survival of cancer cells. It stimulates reactive oxygen species (ROS) in various cancer cell lines. |
| Biochem/physiol Actions: |
NR4A1 (Nur77) antagonist that exhibit potent anticancer activity |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
