Synonym: 4-[(9-Cyclopentyl-7,7-difluoro-6,7,8,9-tetrahydro-5-methyl-6-oxo-5H-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-(1-methyl-4-piperidinyl)benzamide; Ro 3280; Ro3280
CAS Number: 1062243-51-9
Empirical Formula (Hill Notation): C27H35F2N7O3
Molecular Weight: 543.61
MDL Number: MFCD22665717
Linear Formula: C27H35F2N7O3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C27H35F2N7O3/c1-34-12-10-18(11-13-34)31-24(37)17-8-9-20(22(14-17)39-3)32-26-30-15-21-23(33-26)36(19-6-4-5-7-19)16-27(28,29)25(38)35(21)2/h8-9,14-15,18-19H,4-7,10-13,16H2,1-3H3,(H,31,37)(H,30,32,33) |
| InChI key |
DJNZZLZKAXGMMC-UHFFFAOYSA-N |
| SMILES string |
FC1(F)CN(C2CCCC2)C3=NC(NC4=CC=C(C(NC5CCN(C)CC5)=O)C=C4OC)=NC=C3N(C)C1=O |
| solubility |
DMSO: 2 mg/mL, clear |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
potent and selective Polo-like kinase 1 (PLK1) inhibitor |
| Biochem/physiol Actions: |
RO3280 is a potent and selective Polo-like kinase 1 (PLK1) inhibitor. RO3280 induces mitotic catastrophe and apoptosis in human bladder cancer cells and leukemia cells. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
