Synonym: 3-[(4 S)5-Oxo-2-(trifluoromethyl)-1,4,5,6,7,8-hexahydroquinolin-4-yl] benzonitrile; 3-[(4S)-1,4,5,6,7,8-Hexahydro-5-oxo-2-(trifluoromethyl)-4-quinolinyl]-benzonitrile
CAS Number: 172649-40-0
Empirical Formula (Hill Notation): C17H13F3N2O
Molecular Weight: 318.29
MDL Number: MFCD00944017
Linear Formula: C17H13F3N2O
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C17H13F3N2O/c18-17(19,20)15-8-12(11-4-1-3-10(7-11)9-21)16-13(22-15)5-2-6-14(16)23/h1,3-4,7-8,12,22H,2,5-6H2/t12-/m0/s1 |
| InChI key |
RUVMMEREJMHLOS-LBPRGKRZSA-N |
| optical activity |
[α]/D -625 to -575°, c = 0.5 in methanol |
| SMILES string |
O=C1C2=C(NC(C(F)(F)F)=C[C@H]2C3=CC(C#N)=CC=C3)CCC1 |
| solubility |
DMSO: 2 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
potent ATP-sensitive K+ channels (KATP channels) opener |
| Biochem/physiol Actions: |
ZD0947 is potent ATP-sensitive K+ channels (KATP channels) opener. ZD0947 is an effective activator of smooth muscle-type KATP channels (SUR2B/Kir6.1 and SUR2B/Kir6.2) but is a partial antagonist of pancreatic-type KATP channels (i.e. SUR1/Kir6.2) and cardiac-type KATP channels (i.e. SUR2A/Kir6.2). ZD0947 potently inhibits carbacho-induced contraction in the strips of human detrusor. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
