Synonym: 2,5,7,8-Tetramethyl-2-(4′,8′,12′-trimethyltridecyl)-6-chromanol; 5,7,8-Trimethyltocol; D-α-Tocopherol; Vitamin E
CAS Number: 59-02-9
Empirical Formula (Hill Notation): C29H50O2
Molecular Weight: 430.71
EC Number: 200-412-2
MDL Number: MFCD00072045
Linear Formula: C29H50O2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: T1539-100G.
| biological source |
vegetable oil |
| bp |
200-220 °C/0.1 mmHg (lit.) |
| color |
yellow-orange |
| concentration |
≥600 mg/g |
| density |
0.95 g/mL at 25 °C (lit.) |
| form |
liquid (≥0.88M based on potency, density and molecular wt.) |
| format |
neat |
| InChI |
1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
| InChI key |
GVJHHUAWPYXKBD-IEOSBIPESA-N |
| mol wt |
Mw 430.71 g/mol |
| potency |
≥600 mg d-α-tocopherol per g |
| product line |
BioReagent |
| Quality Level |
200  |
| refractive index |
n20/D 1.505 (lit.) |
| SMILES string |
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(O)c(C)c(C)c2O1 |
| solubility |
chloroform: soluble 0.1 mL/mL, clear, faintly yellow to yellow |
| specific activity |
≥1000 IU/g |
| storage temp. |
2-8°C |
| technique(s) |
cell culture | insect: suitable |
| type |
Type VI |
| Application: |
Use in insect cell culture applications as an antioxidant. |
| Other Notes: |
Mixed constitutional (α, β, γ, δ) isomers. |
| Packaging: |
25, 100 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 1 |
| Flash Point(F) |
230.0 °F - closed cup |
| Flash Point(C) |
110 °C - closed cup |
| activity |
specific activity: ≥1000 IU/g |
| bp |
200-220 °C/0.1 mmHg (lit.) |
| Density |
0.95 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.505 (lit.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352205 |