Talsaclidine
SIGMA/T2452 - ≥98% (HPLC), oil
Synonym: (R)
CAS Number: 147025-53-4
Empirical Formula (Hill Notation): C10H15NO
Molecular Weight: 165.23
Linear Formula: C10H15NO
Product Type: Chemical
| assay | ≥98% (HPLC) |
| form | oil |
| InChI | 1S/C10H15NO/c1-2-7-12-10- |
| InChI key | XVFJONKUSLSKSW-JTQLQIEISA |
| Quality Level | 100  |
| SMILES string | C#CCO[C@H]1CN2CC[C@H]1CC2 |
| solubility | DMSO: >5 mg/mL |
| storage temp. | −20°C |
| Biochem/physiol Actions: | Talsaclidine aids in promoting the nonamyloidogenic α-secretase pathway in model systems. It is more effective in stimulating muscarinic M 1 receptors than M 2 and M 3 receptors. In anesthetized guinea pigs, talsaclidine has no bronchospastic effects, but it produces contracture in isolated tracheal muscle. Talsaclidine is considered a potential candidate for cholinergic replacement therapy. |
| Biochem/physiol Actions: | Talsaclidine is a M1 selective muscarinic receptor agonist. Concentration-dependently |
| Features and Benefits: | This compound is featured on the Acetylcholine Receptors (Muscarinic) page of the Handbook of Receptor Classification and Signal Transduction. To browse other handbook pages, click here . |
| Packaging: | 10, 25 mg in glass bottle |
| Packaging: | Packaged under argon |
| Preparation Note: | Talsaclidine is soluble in DMSO at a concentration that is greater than 5 mg/ml. |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |