Tolperisone hydrochloride
SIGMA/T3577 - ≥98% (HPLC), solid
Synonym: Menopatol; 2-
CAS Number: 3644-61-9
Empirical Formula (Hill Notation): C16H23NO · HCl
Molecular Weight: 281.82
EC Number: 222-876-5
MDL Number: MFCD00058211
Linear Formula: C16H23NO · HCl
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white |
| form | solid |
| InChI | 1S/C16H23NO.ClH/c1-13-6-8 |
| InChI key | ZBUVYROEHQQAKL-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | Cl.CC(CN1CCCCC1)C(=O)c2cc |
| solubility | H2O: >20 mg/mL |
| storage condition | desiccated |
| storage temp. | room temp |
| Biochem/physiol Actions: | Tolperisone is an ion channel blocker and centrally acting muscle relaxant. |
| Biochem/physiol Actions: | Tolperisone is derived from piperidine and possesses membrane stabilizing action. It helps in reducing the effect of spasticities associated with the nervous and muscular system. It exhibits muscle relaxant action through attenuating voltage-gated sodium channels in the brain stem. |
| Biochem/physiol Actions: | Tolperisone regulates ionic currents in myelinates axons and subsequently decreases excitability and mediates its antispastic functions3. |
| Packaging: | 50, 250 mg in glass bottle |
| Preparation Note: | Tolperisone hydrochloride dissolves in water at a concentration that is greater than 20 mg/ml. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 - H319 |
| Precautionary statements | P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-52/53 |
| Safety Statements | 36/37-61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | room temp |
| UNSPSC | 12352200 |


