Synonym: TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)); 1,2,3-Tri-(cis,cis,cis-9,12,15-octadecatrienoyl)glycerol; 1,2,3-Trilinolenoylglycerol; Glycerol trilinolenate; Trilinolenin
CAS Number: 14465-68-0
Empirical Formula (Hill Notation): C57H92O6
Molecular Weight: 873.34
EC Number: 238-457-5
MDL Number: MFCD00042898
Linear Formula: C57H92O6
Product Type: Chemical
Representative of vacuum-sealed clear ampule packaging. Non-uniform tips are an inherent feature in this sealing process.
| assay |
≥97% (TLC) |
| biological source |
Linum usitatissimum oil |
| density |
0.94 g/mL at 20 °C (lit.) |
| form |
liquid |
| functional group |
ester |
| InChI |
1S/C57H92O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h7-12,16-21,25-30,54H,4-6,13-15,22-24,31-53H2,1-3H3/b10-7-,11-8-,12-9-,19-16-,20-17-,21-18-,28-25-,29-26-,30-27- |
| InChI key |
UBEIMDKGOYBUKT-FLIQGJDUSA-N |
| lipid type |
neutral glycerides |
| Quality Level |
200  |
| refractive index |
n20/D 1.489 |
| shipped in |
dry ice |
| SMILES string |
CCC=C/CC=C/CC=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=C/CC=C/CC=C/CC)OC(=O)CCCCCCCC=C/CC=C/CC=C/CC |
| storage temp. |
−20°C |
| Application: |
- Quantitation of furan and methylfuran formed in different precursor systems by proton transfer reaction mass spectrometry.: The research quantifies furan and methylfuran production from various precursors using advanced mass spectrometry techniques. These insights are important for food safety and understanding the chemical reactions during food processing (Märk et al., 2006
 ).
|
| Packaging: |
100 mg in ampule |
| Packaging: |
Sealed ampule. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97% (TLC) |
| Density |
0.94 g/mL at 20 °C (lit.) |
| Refractive Index |
n20/D 1.489 |
| Storage Temp. |
−20°C |
| UNSPSC |
41141833 |