UA62784
SIGMA/U3385 - ≥98% (HPLC)
Synonym: 4-
CAS Number: 313367-92-9
Empirical Formula (Hill Notation): C23H15NO3
Molecular Weight: 353.37
MDL Number: MFCD00489199
Linear Formula: C23H15NO3
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | yellow |
| form | powder |
| InChI | 1S/C23H15NO3/c1-26-15-11- |
| InChI key | SVICLWPFAQYZLX-UHFFFAOYSA |
| Quality Level | 100  |
| SMILES string | COc1ccc(cc1)-c2cnc(o2)-c3 |
| solubility | DMSO: >2 mg/mL |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | Studies have also reported that UA62784 associates with tubulin at or near the colchicine-binding sites in cells and functions as a cytotoxic, microtubule inhibitor. |
| Biochem/physiol Actions: | UA62784 is a specific inhibitor of centromere protein E (CENPE) kinesin-like protein; mitotic inhibitor. |
| Biochem/physiol Actions: | UA62784 is a specific inhibitor of centromere protein E (CENPE) kinesin-like protein; mitotic inhibitor. CENP-E is a kinesin-like motor protein that localizes to the kinetochore during mitosis and is essential for bipolar spindle formation. UA62784 is a novel specific inhibitor of CENP-E, which likely binds within the motor domain of CENP-E. UA62784 causes reversible cell cycle arrest in mitosis before metaphase, which leads to apoptosis. The compound is not interacting with microtubules directly. |
| Packaging: | 5, 25 mg in glass bottle |
| Preparation Note: | UA62784 is soluble in DMSO at a concentration >2 mg/ml. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352202 |