Synonym: (+)-3-Hydroxy-17-methylmorphinan; 1,3,4,9,10,10a-Hexahydro-6-hydroxy-2H-10,4a-(iminoethano)-11-methylphenanthrene
CAS Number: 125-73-5
Empirical Formula (Hill Notation): C17H23NO
Molecular Weight: 257.37
EC Number: 204-754-3
MDL Number: MFCD00864199
Linear Formula: C17H23NO
Product Type: Chemical
| color |
white to off-white |
| form |
solid |
| InChI |
1S/C17H23NO/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17/h5-6,11,14,16,19H,2-4,7-10H2,1H3/t14-,16+,17+/m1/s1 |
| InChI key |
JAQUASYNZVUNQP-PVAVHDDUSA-N |
| mp |
≥195 °C |
| optical activity |
[α]/D ≥+54° |
| Quality Level |
200  |
| SMILES string |
CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4ccc(O)cc34 |
| solubility |
saline: soluble(lit.) |
| storage temp. |
2-8°C |
| Application: |
CYP2D6 O-Demethyl metabolite of dextromethorphan |
| Application: |
Dextrorphan has been studies as an N-methyl-D-aspartate (NMDA) receptor antagonist in Xenopus oocytes and hippocampal neuron cultures. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| Preparation Note: |
Dextrorphan is soluble in water. |
| Symbol |
GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| mp |
≥195 °C |
| Storage Temp. |
2-8°C |
| UNSPSC |
12161501 |