Synonym: 5,6-Epoxy-4,27-dihydroxy-1-oxowitha-2,24-dienolide; Withaferine A
CAS Number: 5119-48-2
Empirical Formula (Hill Notation): C28H38O6
Molecular Weight: 470.60
MDL Number: MFCD10687098
Linear Formula: C28H38O6
Product Type: Chemical
| assay |
≥95% (HPLC) |
| biological source |
plant (Withania somnifera) |
| form |
powder |
| functional group |
epoxy |
| |
ketone |
| InChI |
1S/C28H38O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h7-8,15-16,18-21,23-24,29,31H,5-6,9-13H2,1-4H3/t15-,16-,18+,19-,20-,21+,23-,24+,26+,27-,28+/m0/s1 |
| InChI key |
DBRXOUCRJQVYJQ-CKNDUULBSA-N |
| mp |
252-253 °C |
| Quality Level |
200  |
| shipped in |
ambient |
| SMILES string |
C[C@H]([C@H]1CC(C)=C(CO)C(=O)O1)[C@H]2CC[C@H]3[C@@H]4C[C@H]5O[C@]56[C@@H](O)C=CC(=O)[C@]6(C)[C@H]4CC[C@]23C |
| storage temp. |
2-8°C |
| Application: |
Withaferin A was used to treat HEK293 cells to study its effect on cystic fibrosis inflammation. |
| Biochem/physiol Actions: |
Steroidal lactone that exhibits cytotoxicity towards tumor cells. Protective effects attributed to anti-lipid peroxidative, antioxidant and detoxifying functionality. |
| Biochem/physiol Actions: |
Withaferin A is a steroidal lactone that is isolated from the plant Withania somnifera. It has potent anti-inflammatory properties as it inhibits the activation of NF-κ B signaling pathway. The anti-tumor activity of Withaferin A is due to its ability to alter cytoskeletal architecture by binding annexin II and disrupting F actin cross-links. Withaferin A also inhibits angiogenesis by binding to vimentin and F-actin. |
| Preparation Note: |
Withaferin A yields a clear, colorless solution in methanol at 1 mg/ml. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
438.8 °F |
| Flash Point(C) |
226 °C |
| Purity |
≥95% (HPLC) |
| mp |
252-253 °C |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
