2-Amino-5-chlorobenzophenone
USP/1022808 - United States Pharmacopeia (USP) Reference Standard
Synonym: 4-
CAS Number: 719-59-5
Empirical Formula (Hill Notation): C13H10ClNO
Molecular Weight: 231.68
MDL Number: MFCD00007839
Linear Formula: H2NC6H3(Cl)COC6H5
Product Type: Chemical
| API family | chlordiazepoxide , alprazolam, oxazepam; prazepam |
| application(s) | pharmaceutical (small molecule) |
| description | API family: alprazolam |
| format | neat |
| grade | pharmaceutical primary standard |
| InChI | 1S/C13H10ClNO/c14-10-6-7- |
| InChI key | ZUWXHHBROGLWNH-UHFFFAOYSA |
| manufacturer/tradename | USP |
| mp | 96-98 °C (lit.) |
| SMILES string | Nc1ccc(Cl)cc1C(=O)c2ccccc |
| Analysis Note: | These products are for test and assay use only. They are not meant for administration to humans or animals and cannot be used to diagnose, treat, or cure diseases of any kind. |
| Application: | It was used in the determination of chlordiazepoxide and mebeverine HCl using HPLC method. |
| General description: | 2-Amino-5-chlorobenzophen |
| Other Notes: | Sales restrictions may apply. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| mp | 96-98 °C (lit.) |
| UNSPSC | 41116107 |
