Synonym: Chloroquine diphosphate salt; N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt
CAS Number: 50-63-5
Empirical Formula (Hill Notation): C18H26ClN3 · 2H3PO4
Molecular Weight: 515.86
MDL Number: MFCD00069852
Linear Formula: C18H26ClN3 · 2H3PO4
Product Type: Chemical
| agency |
USP |
| API family |
chloroquine |
| application(s) |
pharmaceutical (small molecule) |
| biological source |
synthetic |
| color |
yellow |
| form |
powder |
| format |
neat |
| grade |
pharmaceutical primary standard |
| InChI |
1S/C18H26ClN3.2H3O4P/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;2*1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);2*(H3,1,2,3,4) |
| InChI key |
QKICWELGRMTQCR-UHFFFAOYSA-N |
| manufacturer/tradename |
USP |
| mp |
200 °C (dec.) (lit.) |
| packaging |
pkg of 500 mg |
| pH |
3.5-4.5 (10% in aqueous solution, pH <6.0) |
| SMILES string |
OP(O)(O)=O.OP(O)(O)=O.CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
| solubility |
benzene: practically insoluble |
| |
chloroform: practically insoluble |
| |
ethanol: practically insoluble |
| |
ether: practically insoluble |
| |
water: 50 g/L |
| storage condition |
protect from light |
| storage temp. |
2-8°C |
| vapor pressure |
<0.0000001 kPa ( 25 °C) |
| Analysis Note: |
These products are for test and assay use only. They are not meant for administration to humans or animals and cannot be used to diagnose, treat, or cure diseases of any kind. |
| Application: |
Chloroquine phosphate may be used as a pharmaceutical reference standard for the determination of the analyte in pharmaceutical formulations by chromatography techniques. |
| General description: |
Chloroquine Phosphate is a salt of chloroquine, a 9-aminoquinoline drug that effectively inhibits viral infections in humans. |
| Other Notes: |
Sales restrictions may apply. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P301 + P312 + P330 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| mp |
200 °C (dec.) (lit.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
41116107 |
