Dextran
SUPELCO/00269 - analytical standard, 5,000
CAS Number: 9004-54-0
EC Number: 232-677-5
MDL Number: MFCD00130935
Linear Formula: [C6H10O5]n
Product Type: Chemical
| analyte chemical class(es) | oligosaccharides |
| application(s) | food and beverages |
| form | powder or crystals |
| grade | analytical standard |
| InChI | 1S/C18H32O16/c19-1-5(21)9 |
| InChI key | FZWBNHMXJMCXLU-UHFFFAOYSA |
| Mw/Mn | ~1.60 |
| Quality Level | 100 ![]() |
| SMILES string | O1C(C(C(C(C1CO)O)O)O)OCC2 |
| technique(s) | gel permeation chromatography (GPC): suitable |
| Application: |
|
| General description: | Dextran is a polysaccharide. Dextran fluids behave as colloids; and also are used as plasma substitution. It may have siliconizing effect helping in coating raw serosal surfaces. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352201 |

